About ethyl 4-(dimethylamino)benzoate;xanthen-9-one
ethyl 4-(dimethylamino)benzoate;xanthen-9-one (PubChem CID 67481902) has the molecular formula C24H23NO4
and a molecular weight of 389.45 g/mol. Its IUPAC name is ethyl 4-(dimethylamino)benzoate;xanthen-9-one.
Molecular Properties
| Compound Name | ethyl 4-(dimethylamino)benzoate;xanthen-9-one |
| PubChem CID | 67481902 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | ethyl 4-(dimethylamino)benzoate;xanthen-9-one |
| SMILES | CCOC(=O)c1ccc(N(C)C)cc1.O=c1c2ccccc2oc2ccccc12 |
| InChI | InChI=1S/C13H8O2.C11H15NO2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-4-14-11(13)9-5-7-10(8-6-9)12(2)3/h1-8H;5-8H,4H2,1-3H3 |
| InChIKey | MOBVYHZEVAJNQH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(dimethylamino)benzoate;xanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(dimethylamino)benzoate;xanthen-9-one?
The IUPAC name of ethyl 4-(dimethylamino)benzoate;xanthen-9-one (CID 67481902) is ethyl 4-(dimethylamino)benzoate;xanthen-9-one.
What is the SMILES notation for ethyl 4-(dimethylamino)benzoate;xanthen-9-one?
The canonical SMILES for ethyl 4-(dimethylamino)benzoate;xanthen-9-one is CCOC(=O)c1ccc(N(C)C)cc1.O=c1c2ccccc2oc2ccccc12.
What is the InChIKey of ethyl 4-(dimethylamino)benzoate;xanthen-9-one?
The InChIKey is MOBVYHZEVAJNQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O2.C11H15NO2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-4-14-11(13)9-5-7-10(8-6-9)12(2)3/h1-8H;5-8H,4H2,1-3H3.
What are the key properties of ethyl 4-(dimethylamino)benzoate;xanthen-9-one?
ethyl 4-(dimethylamino)benzoate;xanthen-9-one has a molecular weight of 389.45 g/mol, XLogP of 4.88, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(dimethylamino)benzoate;xanthen-9-one is sourced from PubChem (CID 67481902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).