C19H12O6 — CID 102107921
ethyl 3,12-dioxopyrano[3,2-a]xanthene-2-carboxylate (PubChem CID 102107921) has the molecular formula C19H12O6 and a molecular weight of 336.30 g/mol. Its IUPAC name is ethyl 3,12-dioxopyrano[3,2-a]xanthene-2-carboxylate.
| Compound Name | ethyl 3,12-dioxopyrano[3,2-a]xanthene-2-carboxylate |
|---|---|
| PubChem CID | 102107921 |
| Molecular Formula | C19H12O6 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | ethyl 3,12-dioxopyrano[3,2-a]xanthene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(ccc3oc4ccccc4c(=O)c32)oc1=O |
| InChI | InChI=1S/C19H12O6/c1-2-23-18(21)12-9-11-14(25-19(12)22)7-8-15-16(11)17(20)10-5-3-4-6-13(10)24-15/h3-9H,2H2,1H3 |
| InChIKey | IYVLVNLAVNSLDK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|