C26H22O4 — CID 87515912
ethyl 5,6-dibenzyl-2-oxochromene-3-carboxylate (PubChem CID 87515912) has the molecular formula C26H22O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is ethyl 5,6-dibenzyl-2-oxochromene-3-carboxylate.
| Compound Name | ethyl 5,6-dibenzyl-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 87515912 |
| Molecular Formula | C26H22O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | ethyl 5,6-dibenzyl-2-oxochromene-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(Cc3ccccc3)c(Cc3ccccc3)ccc2oc1=O |
| InChI | InChI=1S/C26H22O4/c1-2-29-25(27)23-17-22-21(16-19-11-7-4-8-12-19)20(13-14-24(22)30-26(23)28)15-18-9-5-3-6-10-18/h3-14,17H,2,15-16H2,1H3 |
| InChIKey | YHFJYSXQKRWCGY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|