C15H13N2O4+ — CID 7056969
ethyl 2-amino-5-oxochromeno[4,3-b]pyridin-1-ium-3-carboxylate (PubChem CID 7056969) has the molecular formula C15H13N2O4+ and a molecular weight of 285.28 g/mol. Its IUPAC name is ethyl 2-amino-5-oxochromeno[4,3-b]pyridin-1-ium-3-carboxylate.
| Compound Name | ethyl 2-amino-5-oxochromeno[4,3-b]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 7056969 |
| Molecular Formula | C15H13N2O4+ |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | ethyl 2-amino-5-oxochromeno[4,3-b]pyridin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)oc3ccccc3c2[nH+]c1N |
| InChI | InChI=1S/C15H12N2O4/c1-2-20-14(18)10-7-9-12(17-13(10)16)8-5-3-4-6-11(8)21-15(9)19/h3-7H,2H2,1H3,(H2,16,17)/p+1 |
| InChIKey | QLPLQFZKLIIWRM-UHFFFAOYSA-O |
| XLogP | 1.52 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|