C16H18N3O2+ — CID 6952701
ethyl 2-amino-9-ethylpyrido[2,3-b]indol-1-ium-3-carboxylate (PubChem CID 6952701) has the molecular formula C16H18N3O2+ and a molecular weight of 284.34 g/mol. Its IUPAC name is ethyl 2-amino-9-ethylpyrido[2,3-b]indol-1-ium-3-carboxylate.
| Compound Name | ethyl 2-amino-9-ethylpyrido[2,3-b]indol-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 6952701 |
| Molecular Formula | C16H18N3O2+ |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | ethyl 2-amino-9-ethylpyrido[2,3-b]indol-1-ium-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c3ccccc3n(CC)c2[nH+]c1N |
| InChI | InChI=1S/C16H17N3O2/c1-3-19-13-8-6-5-7-10(13)11-9-12(16(20)21-4-2)14(17)18-15(11)19/h5-9H,3-4H2,1-2H3,(H2,17,18)/p+1 |
| InChIKey | RUWRGCBGNNYLCB-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |