About acetic acid;9-ethylcarbazol-3-amine
acetic acid;9-ethylcarbazol-3-amine (PubChem CID 68649355) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is acetic acid;9-ethylcarbazol-3-amine.
Molecular Properties
| Compound Name | acetic acid;9-ethylcarbazol-3-amine |
| PubChem CID | 68649355 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | acetic acid;9-ethylcarbazol-3-amine |
| SMILES | CC(=O)O.CCn1c2ccccc2c2cc(N)ccc21 |
| InChI | InChI=1S/C14H14N2.C2H4O2/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16;1-2(3)4/h3-9H,2,15H2,1H3;1H3,(H,3,4) |
| InChIKey | PTRKRMCIZRHYED-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;9-ethylcarbazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;9-ethylcarbazol-3-amine?
The IUPAC name of acetic acid;9-ethylcarbazol-3-amine (CID 68649355) is acetic acid;9-ethylcarbazol-3-amine.
What is the SMILES notation for acetic acid;9-ethylcarbazol-3-amine?
The canonical SMILES for acetic acid;9-ethylcarbazol-3-amine is CC(=O)O.CCn1c2ccccc2c2cc(N)ccc21.
What is the InChIKey of acetic acid;9-ethylcarbazol-3-amine?
The InChIKey is PTRKRMCIZRHYED-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2.C2H4O2/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16;1-2(3)4/h3-9H,2,15H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;9-ethylcarbazol-3-amine?
acetic acid;9-ethylcarbazol-3-amine has a molecular weight of 270.33 g/mol, XLogP of 3.49, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;9-ethylcarbazol-3-amine is sourced from PubChem (CID 68649355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).