C19H20N2O4 — CID 15309070
diethyl 9-ethylpyrido[2,3-b]indole-2,3-dicarboxylate (PubChem CID 15309070) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is diethyl 9-ethylpyrido[2,3-b]indole-2,3-dicarboxylate.
| Compound Name | diethyl 9-ethylpyrido[2,3-b]indole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 15309070 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | diethyl 9-ethylpyrido[2,3-b]indole-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc2c3ccccc3n(CC)c2nc1C(=O)OCC |
| InChI | InChI=1S/C19H20N2O4/c1-4-21-15-10-8-7-9-12(15)13-11-14(18(22)24-5-2)16(20-17(13)21)19(23)25-6-3/h7-11H,4-6H2,1-3H3 |
| InChIKey | LFGFRMUDBZMAOD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |