C15H15N3O2 — CID 164562201
ethyl 3-amino-5-methylpyrido[3,2-b]indole-2-carboxylate (PubChem CID 164562201) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is ethyl 3-amino-5-methylpyrido[3,2-b]indole-2-carboxylate.
| Compound Name | ethyl 3-amino-5-methylpyrido[3,2-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 164562201 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | ethyl 3-amino-5-methylpyrido[3,2-b]indole-2-carboxylate |
| SMILES | CCOC(=O)c1nc2c3ccccc3n(C)c2cc1N |
| InChI | InChI=1S/C15H15N3O2/c1-3-20-15(19)14-10(16)8-12-13(17-14)9-6-4-5-7-11(9)18(12)2/h4-8H,3,16H2,1-2H3 |
| InChIKey | QCTBCAXBGFHXHD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |