C24H30N4O3Si — CID 156678798
ethyl 5-(9-methylcarbazol-2-yl)-2-(2-trimethylsilylethoxymethyl)triazole-4-carboxylate (PubChem CID 156678798) has the molecular formula C24H30N4O3Si and a molecular weight of 450.62 g/mol. Its IUPAC name is ethyl 5-(9-methylcarbazol-2-yl)-2-(2-trimethylsilylethoxymethyl)triazole-4-carboxylate.
| Compound Name | ethyl 5-(9-methylcarbazol-2-yl)-2-(2-trimethylsilylethoxymethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 156678798 |
| Molecular Formula | C24H30N4O3Si |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | ethyl 5-(9-methylcarbazol-2-yl)-2-(2-trimethylsilylethoxymethyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nn(COCC[Si](C)(C)C)nc1-c1ccc2c3ccccc3n(C)c2c1 |
| InChI | InChI=1S/C24H30N4O3Si/c1-6-31-24(29)23-22(25-28(26-23)16-30-13-14-32(3,4)5)17-11-12-19-18-9-7-8-10-20(18)27(2)21(19)15-17/h7-12,15H,6,13-14,16H2,1-5H3 |
| InChIKey | JJQDERGGDAKAOL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|