C13H22N2O4Si — CID 59006647
ethyl 6-oxo-1-(2-trimethylsilylethoxymethyl)pyrimidine-4-carboxylate (PubChem CID 59006647) has the molecular formula C13H22N2O4Si and a molecular weight of 298.42 g/mol. Its IUPAC name is ethyl 6-oxo-1-(2-trimethylsilylethoxymethyl)pyrimidine-4-carboxylate.
| Compound Name | ethyl 6-oxo-1-(2-trimethylsilylethoxymethyl)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 59006647 |
| Molecular Formula | C13H22N2O4Si |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | ethyl 6-oxo-1-(2-trimethylsilylethoxymethyl)pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)n(COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C13H22N2O4Si/c1-5-19-13(17)11-8-12(16)15(9-14-11)10-18-6-7-20(2,3)4/h8-9H,5-7,10H2,1-4H3 |
| InChIKey | SGUXIYPFGKMPHA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|