C17H24N6O3Si — CID 155786281
ethyl 2-imidazol-1-yl-7-(2-trimethylsilylethoxymethyl)purine-6-carboxylate (PubChem CID 155786281) has the molecular formula C17H24N6O3Si and a molecular weight of 388.50 g/mol. Its IUPAC name is ethyl 2-imidazol-1-yl-7-(2-trimethylsilylethoxymethyl)purine-6-carboxylate.
| Compound Name | ethyl 2-imidazol-1-yl-7-(2-trimethylsilylethoxymethyl)purine-6-carboxylate |
|---|---|
| PubChem CID | 155786281 |
| Molecular Formula | C17H24N6O3Si |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | ethyl 2-imidazol-1-yl-7-(2-trimethylsilylethoxymethyl)purine-6-carboxylate |
| SMILES | CCOC(=O)c1nc(-n2ccnc2)nc2ncn(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C17H24N6O3Si/c1-5-26-16(24)13-14-15(21-17(20-13)22-7-6-18-10-22)19-11-23(14)12-25-8-9-27(2,3)4/h6-7,10-11H,5,8-9,12H2,1-4H3 |
| InChIKey | XEXMKXKUAZAJED-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 96.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|