C16H23ClN2O3Si — CID 166476125
ethyl 7-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carboxylate (PubChem CID 166476125) has the molecular formula C16H23ClN2O3Si and a molecular weight of 354.91 g/mol. Its IUPAC name is ethyl 7-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carboxylate.
| Compound Name | ethyl 7-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 166476125 |
| Molecular Formula | C16H23ClN2O3Si |
| Molecular Weight | 354.91 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | ethyl 7-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2ccnc(Cl)c2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H23ClN2O3Si/c1-5-22-16(20)13-10-12-6-7-18-15(17)14(12)19(13)11-21-8-9-23(2,3)4/h6-7,10H,5,8-9,11H2,1-4H3 |
| InChIKey | WRRDITJAAPKKIV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.91 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|