C15H24N2O3SSi — CID 22387741
ethyl 2-methyl-1-(2-trimethylsilylethoxymethyl)thieno[2,3-d]imidazole-5-carboxylate (PubChem CID 22387741) has the molecular formula C15H24N2O3SSi and a molecular weight of 340.52 g/mol. Its IUPAC name is ethyl 2-methyl-1-(2-trimethylsilylethoxymethyl)thieno[2,3-d]imidazole-5-carboxylate.
| Compound Name | ethyl 2-methyl-1-(2-trimethylsilylethoxymethyl)thieno[2,3-d]imidazole-5-carboxylate |
|---|---|
| PubChem CID | 22387741 |
| Molecular Formula | C15H24N2O3SSi |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | ethyl 2-methyl-1-(2-trimethylsilylethoxymethyl)thieno[2,3-d]imidazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(nc(C)n2COCC[Si](C)(C)C)s1 |
| InChI | InChI=1S/C15H24N2O3SSi/c1-6-20-15(18)13-9-12-14(21-13)16-11(2)17(12)10-19-7-8-22(3,4)5/h9H,6-8,10H2,1-5H3 |
| InChIKey | QNTLRGCNNHTODS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|