C16H21ClF2N2O3Si — CID 145190736
ethyl 2-chloro-6,7-difluoro-3-(2-trimethylsilylethoxymethyl)benzimidazole-4-carboxylate (PubChem CID 145190736) has the molecular formula C16H21ClF2N2O3Si and a molecular weight of 390.89 g/mol. Its IUPAC name is ethyl 2-chloro-6,7-difluoro-3-(2-trimethylsilylethoxymethyl)benzimidazole-4-carboxylate.
| Compound Name | ethyl 2-chloro-6,7-difluoro-3-(2-trimethylsilylethoxymethyl)benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 145190736 |
| Molecular Formula | C16H21ClF2N2O3Si |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | ethyl 2-chloro-6,7-difluoro-3-(2-trimethylsilylethoxymethyl)benzimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cc(F)c(F)c2nc(Cl)n(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C16H21ClF2N2O3Si/c1-5-24-15(22)10-8-11(18)12(19)13-14(10)21(16(17)20-13)9-23-6-7-25(2,3)4/h8H,5-7,9H2,1-4H3 |
| InChIKey | AVOOWVBFKGUPNY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|