C14H20ClN3O3Si — CID 140752402
methyl 2-chloro-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridine-7-carboxylate (PubChem CID 140752402) has the molecular formula C14H20ClN3O3Si and a molecular weight of 341.87 g/mol. Its IUPAC name is methyl 2-chloro-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridine-7-carboxylate.
| Compound Name | methyl 2-chloro-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 140752402 |
| Molecular Formula | C14H20ClN3O3Si |
| Molecular Weight | 341.87 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | methyl 2-chloro-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridine-7-carboxylate |
| SMILES | COC(=O)c1ccnc2nc(Cl)n(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C14H20ClN3O3Si/c1-20-13(19)10-5-6-16-12-11(10)18(14(15)17-12)9-21-7-8-22(2,3)4/h5-6H,7-9H2,1-4H3 |
| InChIKey | ZSSQOIYRFVQYKG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.87 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|