C20H21BrClN5O3Si — CID 140863097
4-(3-bromophenyl)-3-[2-chloro-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-7-yl]-1,2,4-oxadiazol-5-one (PubChem CID 140863097) has the molecular formula C20H21BrClN5O3Si and a molecular weight of 522.86 g/mol. Its IUPAC name is 4-(3-bromophenyl)-3-[2-chloro-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-7-yl]-1,2,4-oxadiazol-5-one.
| Compound Name | 4-(3-bromophenyl)-3-[2-chloro-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-7-yl]-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 140863097 |
| Molecular Formula | C20H21BrClN5O3Si |
| Molecular Weight | 522.86 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | 4-(3-bromophenyl)-3-[2-chloro-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-7-yl]-1,2,4-oxadiazol-5-one |
| SMILES | C[Si](C)(C)CCOCn1c(Cl)nc2nccc(-c3noc(=O)n3-c3cccc(Br)c3)c21 |
| InChI | InChI=1S/C20H21BrClN5O3Si/c1-31(2,3)10-9-29-12-26-16-15(7-8-23-17(16)24-19(26)22)18-25-30-20(28)27(18)14-6-4-5-13(21)11-14/h4-8,11H,9-10,12H2,1-3H3 |
| InChIKey | RBUKXAHCZXRWFA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 87.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.86 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|