C19H22BrClN4OSi — CID 59137278
2-[[4-bromo-5-(2-chloropyrimidin-4-yl)-2-phenylimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 59137278) has the molecular formula C19H22BrClN4OSi and a molecular weight of 465.86 g/mol. Its IUPAC name is 2-[[4-bromo-5-(2-chloropyrimidin-4-yl)-2-phenylimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-bromo-5-(2-chloropyrimidin-4-yl)-2-phenylimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 59137278 |
| Molecular Formula | C19H22BrClN4OSi |
| Molecular Weight | 465.86 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 2-[[4-bromo-5-(2-chloropyrimidin-4-yl)-2-phenylimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccccc2)nc(Br)c1-c1ccnc(Cl)n1 |
| InChI | InChI=1S/C19H22BrClN4OSi/c1-27(2,3)12-11-26-13-25-16(15-9-10-22-19(21)23-15)17(20)24-18(25)14-7-5-4-6-8-14/h4-10H,11-13H2,1-3H3 |
| InChIKey | CFURVZLPHWWYSO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.86 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|