C21H26N2OSi — CID 102185967
2-[(2,5-diphenylimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 102185967) has the molecular formula C21H26N2OSi and a molecular weight of 350.54 g/mol. Its IUPAC name is 2-[(2,5-diphenylimidazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(2,5-diphenylimidazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 102185967 |
| Molecular Formula | C21H26N2OSi |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-[(2,5-diphenylimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccccc2)cnc1-c1ccccc1 |
| InChI | InChI=1S/C21H26N2OSi/c1-25(2,3)15-14-24-17-23-20(18-10-6-4-7-11-18)16-22-21(23)19-12-8-5-9-13-19/h4-13,16H,14-15,17H2,1-3H3 |
| InChIKey | VPOUIQMCLXIVRZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|