C19H22BrFN2OSi — CID 170762564
2-[(2-bromo-6-fluoro-3-phenylpyrrolo[3,2-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 170762564) has the molecular formula C19H22BrFN2OSi and a molecular weight of 421.39 g/mol. Its IUPAC name is 2-[(2-bromo-6-fluoro-3-phenylpyrrolo[3,2-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(2-bromo-6-fluoro-3-phenylpyrrolo[3,2-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 170762564 |
| Molecular Formula | C19H22BrFN2OSi |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 2-[(2-bromo-6-fluoro-3-phenylpyrrolo[3,2-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(Br)c(-c2ccccc2)c2ncc(F)cc21 |
| InChI | InChI=1S/C19H22BrFN2OSi/c1-25(2,3)10-9-24-13-23-16-11-15(21)12-22-18(16)17(19(23)20)14-7-5-4-6-8-14/h4-8,11-12H,9-10,13H2,1-3H3 |
| InChIKey | RLWUDEOURNRZGL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|