C21H27BrN2O2Si — CID 46221162
2-[(6-bromo-2-methyl-4-phenylmethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 46221162) has the molecular formula C21H27BrN2O2Si and a molecular weight of 447.45 g/mol. Its IUPAC name is 2-[(6-bromo-2-methyl-4-phenylmethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(6-bromo-2-methyl-4-phenylmethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 46221162 |
| Molecular Formula | C21H27BrN2O2Si |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 2-[(6-bromo-2-methyl-4-phenylmethoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nc2c(OCc3ccccc3)cc(Br)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C21H27BrN2O2Si/c1-16-23-21-19(24(16)15-25-10-11-27(2,3)4)12-18(22)13-20(21)26-14-17-8-6-5-7-9-17/h5-9,12-13H,10-11,14-15H2,1-4H3 |
| InChIKey | BVKMBKUZDOHAJH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|