C26H35N3O3Si — CID 15604455
(8S)-N,N,2-trimethyl-8-phenyl-3-(2-trimethylsilylethoxymethyl)-7,8-dihydro-6H-pyrano[2,3-e]benzimidazole-5-carboxamide (PubChem CID 15604455) has the molecular formula C26H35N3O3Si and a molecular weight of 465.67 g/mol. Its IUPAC name is (8S)-N,N,2-trimethyl-8-phenyl-3-(2-trimethylsilylethoxymethyl)-7,8-dihydro-6H-pyrano[2,3-e]benzimidazole-5-carboxamide.
| Compound Name | (8S)-N,N,2-trimethyl-8-phenyl-3-(2-trimethylsilylethoxymethyl)-7,8-dihydro-6H-pyrano[2,3-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 15604455 |
| Molecular Formula | C26H35N3O3Si |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | (8S)-N,N,2-trimethyl-8-phenyl-3-(2-trimethylsilylethoxymethyl)-7,8-dihydro-6H-pyrano[2,3-e]benzimidazole-5-carboxamide |
| SMILES | Cc1nc2c3c(c(C(=O)N(C)C)cc2n1COCC[Si](C)(C)C)CC[C@@H](c1ccccc1)O3 |
| InChI | InChI=1S/C26H35N3O3Si/c1-18-27-24-22(29(18)17-31-14-15-33(4,5)6)16-21(26(30)28(2)3)20-12-13-23(32-25(20)24)19-10-8-7-9-11-19/h7-11,16,23H,12-15,17H2,1-6H3/t23-/m0/s1 |
| InChIKey | KJIWUXWUMQXMOY-QHCPKHFHSA-N |
| XLogP | 5.43 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|