C20H21N3O2 — CID 69135096
N,N,2-trimethyl-8-phenyl-3,6,7,8-tetrahydropyrano[2,3-e]benzimidazole-5-carboxamide (PubChem CID 69135096) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N,N,2-trimethyl-8-phenyl-3,6,7,8-tetrahydropyrano[2,3-e]benzimidazole-5-carboxamide.
| Compound Name | N,N,2-trimethyl-8-phenyl-3,6,7,8-tetrahydropyrano[2,3-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 69135096 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N,N,2-trimethyl-8-phenyl-3,6,7,8-tetrahydropyrano[2,3-e]benzimidazole-5-carboxamide |
| SMILES | Cc1nc2c3c(c(C(=O)N(C)C)cc2[nH]1)CCC(c1ccccc1)O3 |
| InChI | InChI=1S/C20H21N3O2/c1-12-21-16-11-15(20(24)23(2)3)14-9-10-17(13-7-5-4-6-8-13)25-19(14)18(16)22-12/h4-8,11,17H,9-10H2,1-3H3,(H,21,22) |
| InChIKey | SXBZXIJSXLIGIA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |