C19H18N2O2S — CID 87846358
2,3-dimethyl-8-phenyl-7,8-dihydro-6H-pyrano[2,3-e]benzimidazole-5-carbothioic S-acid (PubChem CID 87846358) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is 2,3-dimethyl-8-phenyl-7,8-dihydro-6H-pyrano[2,3-e]benzimidazole-5-carbothioic S-acid.
| Compound Name | 2,3-dimethyl-8-phenyl-7,8-dihydro-6H-pyrano[2,3-e]benzimidazole-5-carbothioic S-acid |
|---|---|
| PubChem CID | 87846358 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2,3-dimethyl-8-phenyl-7,8-dihydro-6H-pyrano[2,3-e]benzimidazole-5-carbothioic S-acid |
| SMILES | Cc1nc2c3c(c(C(=O)S)cc2n1C)CCC(c1ccccc1)O3 |
| InChI | InChI=1S/C19H18N2O2S/c1-11-20-17-15(21(11)2)10-14(19(22)24)13-8-9-16(23-18(13)17)12-6-4-3-5-7-12/h3-7,10,16H,8-9H2,1-2H3,(H,22,24) |
| InChIKey | GFBBZUXHFCFKNY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|