C22H29BrN4O3Si — CID 66820472
benzyl N-[[6-bromo-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]methyl]-N-methylcarbamate (PubChem CID 66820472) has the molecular formula C22H29BrN4O3Si and a molecular weight of 505.49 g/mol. Its IUPAC name is benzyl N-[[6-bromo-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]methyl]-N-methylcarbamate.
| Compound Name | benzyl N-[[6-bromo-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 66820472 |
| Molecular Formula | C22H29BrN4O3Si |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | benzyl N-[[6-bromo-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1nc2cc(Br)cnc2n1COCC[Si](C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H29BrN4O3Si/c1-26(22(28)30-15-17-8-6-5-7-9-17)14-20-25-19-12-18(23)13-24-21(19)27(20)16-29-10-11-31(2,3)4/h5-9,12-13H,10-11,14-16H2,1-4H3 |
| InChIKey | IUHIZGLMKAIWDH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|