C25H27ClN6O2Si — CID 86614102
2-[[2-chloro-6-(6-phenylmethoxybenzimidazol-1-yl)purin-9-yl]methoxy]ethyl-trimethylsilane (PubChem CID 86614102) has the molecular formula C25H27ClN6O2Si and a molecular weight of 507.07 g/mol. Its IUPAC name is 2-[[2-chloro-6-(6-phenylmethoxybenzimidazol-1-yl)purin-9-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-chloro-6-(6-phenylmethoxybenzimidazol-1-yl)purin-9-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 86614102 |
| Molecular Formula | C25H27ClN6O2Si |
| Molecular Weight | 507.07 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 2-[[2-chloro-6-(6-phenylmethoxybenzimidazol-1-yl)purin-9-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cnc2c(-n3cnc4ccc(OCc5ccccc5)cc43)nc(Cl)nc21 |
| InChI | InChI=1S/C25H27ClN6O2Si/c1-35(2,3)12-11-33-17-31-15-28-22-23(31)29-25(26)30-24(22)32-16-27-20-10-9-19(13-21(20)32)34-14-18-7-5-4-6-8-18/h4-10,13,15-16H,11-12,14,17H2,1-3H3 |
| InChIKey | MAZWGJNZZWDXJK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.07 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|