C19H23BrN2O2Si — CID 154675122
2-[(5-bromo-4-phenoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 154675122) has the molecular formula C19H23BrN2O2Si and a molecular weight of 419.40 g/mol. Its IUPAC name is 2-[(5-bromo-4-phenoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(5-bromo-4-phenoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 154675122 |
| Molecular Formula | C19H23BrN2O2Si |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2-[(5-bromo-4-phenoxybenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cnc2c(Oc3ccccc3)c(Br)ccc21 |
| InChI | InChI=1S/C19H23BrN2O2Si/c1-25(2,3)12-11-23-14-22-13-21-18-17(22)10-9-16(20)19(18)24-15-7-5-4-6-8-15/h4-10,13H,11-12,14H2,1-3H3 |
| InChIKey | OFKRRXCCIKAWNZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|