C11H17BrN4OSi — CID 131742099
2-[(5-bromoimidazo[4,5-b]pyrazin-3-yl)methoxy]ethyl-trimethylsilane (PubChem CID 131742099) has the molecular formula C11H17BrN4OSi and a molecular weight of 329.27 g/mol. Its IUPAC name is 2-[(5-bromoimidazo[4,5-b]pyrazin-3-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(5-bromoimidazo[4,5-b]pyrazin-3-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 131742099 |
| Molecular Formula | C11H17BrN4OSi |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-[(5-bromoimidazo[4,5-b]pyrazin-3-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cnc2ncc(Br)nc21 |
| InChI | InChI=1S/C11H17BrN4OSi/c1-18(2,3)5-4-17-8-16-7-14-10-11(16)15-9(12)6-13-10/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | TVPDMOQRPYUULL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|