C19H28BrN3O3Si — CID 141242228
2-[[2-bromo-7-(2-tert-butyl-1,3-dioxol-2-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 141242228) has the molecular formula C19H28BrN3O3Si and a molecular weight of 454.44 g/mol. Its IUPAC name is 2-[[2-bromo-7-(2-tert-butyl-1,3-dioxol-2-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-bromo-7-(2-tert-butyl-1,3-dioxol-2-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 141242228 |
| Molecular Formula | C19H28BrN3O3Si |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-[[2-bromo-7-(2-tert-butyl-1,3-dioxol-2-yl)pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC(C)(C)C1(c2cn(COCC[Si](C)(C)C)c3ncc(Br)nc23)OC=CO1 |
| InChI | InChI=1S/C19H28BrN3O3Si/c1-18(2,3)19(25-7-8-26-19)14-12-23(13-24-9-10-27(4,5)6)17-16(14)22-15(20)11-21-17/h7-8,11-12H,9-10,13H2,1-6H3 |
| InChIKey | NJBOTNLYCHWGFM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|