C20H26BrN5O2Si — CID 86677968
2-bromo-N-(1-pyridin-4-ylethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 86677968) has the molecular formula C20H26BrN5O2Si and a molecular weight of 476.45 g/mol. Its IUPAC name is 2-bromo-N-(1-pyridin-4-ylethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-bromo-N-(1-pyridin-4-ylethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 86677968 |
| Molecular Formula | C20H26BrN5O2Si |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 2-bromo-N-(1-pyridin-4-ylethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(Br)nc12)c1ccncc1 |
| InChI | InChI=1S/C20H26BrN5O2Si/c1-14(15-5-7-22-8-6-15)24-20(27)16-12-26(13-28-9-10-29(2,3)4)19-18(16)25-17(21)11-23-19/h5-8,11-12,14H,9-10,13H2,1-4H3,(H,24,27) |
| InChIKey | LKKZQTYEODCPQN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|