C21H30N6O2Si — CID 67008846
2-cyclopropyl-N-[(1S)-1-(1H-pyrazol-5-yl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 67008846) has the molecular formula C21H30N6O2Si and a molecular weight of 426.60 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(1S)-1-(1H-pyrazol-5-yl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-cyclopropyl-N-[(1S)-1-(1H-pyrazol-5-yl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 67008846 |
| Molecular Formula | C21H30N6O2Si |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2-cyclopropyl-N-[(1S)-1-(1H-pyrazol-5-yl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C[C@H](NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(C3CC3)nc12)c1ccn[nH]1 |
| InChI | InChI=1S/C21H30N6O2Si/c1-14(17-7-8-23-26-17)24-21(28)16-12-27(13-29-9-10-30(2,3)4)20-19(16)25-18(11-22-20)15-5-6-15/h7-8,11-12,14-15H,5-6,9-10,13H2,1-4H3,(H,23,26)(H,24,28)/t14-/m0/s1 |
| InChIKey | JHBMRCDXJIHJPJ-AWEZNQCLSA-N |
| XLogP | 3.84 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|