C19H30BrN5O2Si — CID 71574168
2-bromo-N-(4-methylpiperidin-4-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71574168) has the molecular formula C19H30BrN5O2Si and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-bromo-N-(4-methylpiperidin-4-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-bromo-N-(4-methylpiperidin-4-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71574168 |
| Molecular Formula | C19H30BrN5O2Si |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 2-bromo-N-(4-methylpiperidin-4-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC1(NC(=O)c2cn(COCC[Si](C)(C)C)c3ncc(Br)nc23)CCNCC1 |
| InChI | InChI=1S/C19H30BrN5O2Si/c1-19(5-7-21-8-6-19)24-18(26)14-12-25(13-27-9-10-28(2,3)4)17-16(14)23-15(20)11-22-17/h11-12,21H,5-10,13H2,1-4H3,(H,24,26) |
| InChIKey | XVTADVODDMYEIS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|