C24H39N5O4Si — CID 67009271
(3-amino-2,2-dimethyl-3-oxopropyl) 2-(3,3-dimethylpyrrolidin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylate (PubChem CID 67009271) has the molecular formula C24H39N5O4Si and a molecular weight of 489.69 g/mol. Its IUPAC name is (3-amino-2,2-dimethyl-3-oxopropyl) 2-(3,3-dimethylpyrrolidin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylate.
| Compound Name | (3-amino-2,2-dimethyl-3-oxopropyl) 2-(3,3-dimethylpyrrolidin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 67009271 |
| Molecular Formula | C24H39N5O4Si |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | (3-amino-2,2-dimethyl-3-oxopropyl) 2-(3,3-dimethylpyrrolidin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylate |
| SMILES | CC1(C)CCN(c2cnc3c(n2)c(C(=O)OCC(C)(C)C(N)=O)cn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C24H39N5O4Si/c1-23(2)8-9-28(14-23)18-12-26-20-19(27-18)17(21(30)33-15-24(3,4)22(25)31)13-29(20)16-32-10-11-34(5,6)7/h12-13H,8-11,14-16H2,1-7H3,(H2,25,31) |
| InChIKey | FABIWDRJCOVEQM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|