C22H35N7O2Si — CID 131735557
N-tert-butyl-2-[(1-ethylpyrazol-4-yl)amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 131735557) has the molecular formula C22H35N7O2Si and a molecular weight of 457.66 g/mol. Its IUPAC name is N-tert-butyl-2-[(1-ethylpyrazol-4-yl)amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-[(1-ethylpyrazol-4-yl)amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 131735557 |
| Molecular Formula | C22H35N7O2Si |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | N-tert-butyl-2-[(1-ethylpyrazol-4-yl)amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CCn1cc(Nc2cnc3c(n2)c(C(=O)NC(C)(C)C)cn3COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C22H35N7O2Si/c1-8-29-13-16(11-24-29)25-18-12-23-20-19(26-18)17(21(30)27-22(2,3)4)14-28(20)15-31-9-10-32(5,6)7/h11-14H,8-10,15H2,1-7H3,(H,25,26)(H,27,30) |
| InChIKey | HAAZMOGIGUDUMC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|