C26H36N6O3Si — CID 71279513
N-tert-butyl-2-(5-methoxy-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71279513) has the molecular formula C26H36N6O3Si and a molecular weight of 508.70 g/mol. Its IUPAC name is N-tert-butyl-2-(5-methoxy-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-(5-methoxy-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71279513 |
| Molecular Formula | C26H36N6O3Si |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | N-tert-butyl-2-(5-methoxy-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | COc1ccc2c(c1)c(-c1cnc3c(n1)c(C(=O)NC(C)(C)C)cn3COCC[Si](C)(C)C)nn2C |
| InChI | InChI=1S/C26H36N6O3Si/c1-26(2,3)29-25(33)19-15-32(16-35-11-12-36(6,7)8)24-23(19)28-20(14-27-24)22-18-13-17(34-5)9-10-21(18)31(4)30-22/h9-10,13-15H,11-12,16H2,1-8H3,(H,29,33) |
| InChIKey | ZPCHNQAOZPPMNC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|