C26H33N7O2Si — CID 71280392
N-tert-butyl-2-(5-cyano-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71280392) has the molecular formula C26H33N7O2Si and a molecular weight of 503.68 g/mol. Its IUPAC name is N-tert-butyl-2-(5-cyano-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-(5-cyano-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71280392 |
| Molecular Formula | C26H33N7O2Si |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | N-tert-butyl-2-(5-cyano-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | Cn1nc(-c2cnc3c(n2)c(C(=O)NC(C)(C)C)cn3COCC[Si](C)(C)C)c2cc(C#N)ccc21 |
| InChI | InChI=1S/C26H33N7O2Si/c1-26(2,3)30-25(34)19-15-33(16-35-10-11-36(5,6)7)24-23(19)29-20(14-28-24)22-18-12-17(13-27)8-9-21(18)32(4)31-22/h8-9,12,14-15H,10-11,16H2,1-7H3,(H,30,34) |
| InChIKey | PJKMFEZRXPYZNI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|