C18H24BrN5O3Si — CID 89424916
2-bromo-N-[(1S)-1-(1,3-oxazol-2-yl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 89424916) has the molecular formula C18H24BrN5O3Si and a molecular weight of 466.41 g/mol. Its IUPAC name is 2-bromo-N-[(1S)-1-(1,3-oxazol-2-yl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-bromo-N-[(1S)-1-(1,3-oxazol-2-yl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 89424916 |
| Molecular Formula | C18H24BrN5O3Si |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 2-bromo-N-[(1S)-1-(1,3-oxazol-2-yl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C[C@H](NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(Br)nc12)c1ncco1 |
| InChI | InChI=1S/C18H24BrN5O3Si/c1-12(18-20-5-6-27-18)22-17(25)13-10-24(11-26-7-8-28(2,3)4)16-15(13)23-14(19)9-21-16/h5-6,9-10,12H,7-8,11H2,1-4H3,(H,22,25)/t12-/m0/s1 |
| InChIKey | WMYDRLOMNRDJSN-LBPRGKRZSA-N |
| XLogP | 3.99 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|