C18H28BrN5O3Si — CID 71574172
N-[(3R,5S)-5-aminooxan-3-yl]-2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71574172) has the molecular formula C18H28BrN5O3Si and a molecular weight of 470.44 g/mol. Its IUPAC name is N-[(3R,5S)-5-aminooxan-3-yl]-2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-[(3R,5S)-5-aminooxan-3-yl]-2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71574172 |
| Molecular Formula | C18H28BrN5O3Si |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-[(3R,5S)-5-aminooxan-3-yl]-2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)N[C@H]2COC[C@@H](N)C2)c2nc(Br)cnc21 |
| InChI | InChI=1S/C18H28BrN5O3Si/c1-28(2,3)5-4-26-11-24-8-14(16-17(24)21-7-15(19)23-16)18(25)22-13-6-12(20)9-27-10-13/h7-8,12-13H,4-6,9-11,20H2,1-3H3,(H,22,25)/t12-,13+/m0/s1 |
| InChIKey | JVNCITDASSQYIP-QWHCGFSZSA-N |
| XLogP | 2.35 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|