C28H34FN7O2Si — CID 71285589
N-[(1S,3R)-3-(cyanomethyl)cyclopentyl]-2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71285589) has the molecular formula C28H34FN7O2Si and a molecular weight of 547.71 g/mol. Its IUPAC name is N-[(1S,3R)-3-(cyanomethyl)cyclopentyl]-2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-[(1S,3R)-3-(cyanomethyl)cyclopentyl]-2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71285589 |
| Molecular Formula | C28H34FN7O2Si |
| Molecular Weight | 547.71 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | N-[(1S,3R)-3-(cyanomethyl)cyclopentyl]-2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | Cn1nc(-c2cnc3c(n2)c(C(=O)N[C@H]2CC[C@@H](CC#N)C2)cn3COCC[Si](C)(C)C)c2ccc(F)cc21 |
| InChI | InChI=1S/C28H34FN7O2Si/c1-35-24-14-19(29)6-8-21(24)25(34-35)23-15-31-27-26(33-23)22(16-36(27)17-38-11-12-39(2,3)4)28(37)32-20-7-5-18(13-20)9-10-30/h6,8,14-16,18,20H,5,7,9,11-13,17H2,1-4H3,(H,32,37)/t18-,20-/m0/s1 |
| InChIKey | KKXTUKUIYKQXJS-ICSRJNTNSA-N |
| XLogP | 5.25 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|