C30H40FN7O4Si — CID 71279534
tert-butyl N-[3-[[2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbonyl]amino]cyclobutyl]carbamate (PubChem CID 71279534) has the molecular formula C30H40FN7O4Si and a molecular weight of 609.78 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbonyl]amino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbonyl]amino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 71279534 |
| Molecular Formula | C30H40FN7O4Si |
| Molecular Weight | 609.78 g/mol |
| Exact Mass | 609.29 |
| IUPAC Name | tert-butyl N-[3-[[2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbonyl]amino]cyclobutyl]carbamate |
| SMILES | Cn1nc(-c2cnc3c(n2)c(C(=O)NC2CC(NC(=O)OC(C)(C)C)C2)cn3COCC[Si](C)(C)C)c2ccc(F)cc21 |
| InChI | InChI=1S/C30H40FN7O4Si/c1-30(2,3)42-29(40)34-20-13-19(14-20)33-28(39)22-16-38(17-41-10-11-43(5,6)7)27-26(22)35-23(15-32-27)25-21-9-8-18(31)12-24(21)37(4)36-25/h8-9,12,15-16,19-20H,10-11,13-14,17H2,1-7H3,(H,33,39)(H,34,40) |
| InChIKey | MAUSVVDSNXFAPU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.78 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|