C21H24FN5O2Si — CID 86677986
2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbaldehyde (PubChem CID 86677986) has the molecular formula C21H24FN5O2Si and a molecular weight of 425.54 g/mol. Its IUPAC name is 2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbaldehyde.
| Compound Name | 2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbaldehyde |
|---|---|
| PubChem CID | 86677986 |
| Molecular Formula | C21H24FN5O2Si |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbaldehyde |
| SMILES | Cn1nc(-c2cnc3c(n2)c(C=O)cn3COCC[Si](C)(C)C)c2ccc(F)cc21 |
| InChI | InChI=1S/C21H24FN5O2Si/c1-26-18-9-15(22)5-6-16(18)20(25-26)17-10-23-21-19(24-17)14(12-28)11-27(21)13-29-7-8-30(2,3)4/h5-6,9-12H,7-8,13H2,1-4H3 |
| InChIKey | IYXVMCAFGGHSGF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|