C25H33FN6O4Si — CID 71288955
N-[(2R,3S)-1,3-dihydroxybutan-2-yl]-2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71288955) has the molecular formula C25H33FN6O4Si and a molecular weight of 528.66 g/mol. Its IUPAC name is N-[(2R,3S)-1,3-dihydroxybutan-2-yl]-2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-[(2R,3S)-1,3-dihydroxybutan-2-yl]-2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71288955 |
| Molecular Formula | C25H33FN6O4Si |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | N-[(2R,3S)-1,3-dihydroxybutan-2-yl]-2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C[C@H](O)[C@@H](CO)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(C)c4cc(F)ccc34)nc12 |
| InChI | InChI=1S/C25H33FN6O4Si/c1-15(34)20(13-33)29-25(35)18-12-32(14-36-8-9-37(3,4)5)24-23(18)28-19(11-27-24)22-17-7-6-16(26)10-21(17)31(2)30-22/h6-7,10-12,15,20,33-34H,8-9,13-14H2,1-5H3,(H,29,35)/t15-,20+/m0/s1 |
| InChIKey | QFRYWTHHSGJHHO-MGPUTAFESA-N |
| XLogP | 2.91 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|