C27H32ClN7O2Si — CID 86677960
2-(6-chloro-1-methylindazol-3-yl)-N-[(1R)-1-(2-cyanocyclopropyl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 86677960) has the molecular formula C27H32ClN7O2Si and a molecular weight of 550.14 g/mol. Its IUPAC name is 2-(6-chloro-1-methylindazol-3-yl)-N-[(1R)-1-(2-cyanocyclopropyl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-(6-chloro-1-methylindazol-3-yl)-N-[(1R)-1-(2-cyanocyclopropyl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 86677960 |
| Molecular Formula | C27H32ClN7O2Si |
| Molecular Weight | 550.14 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | 2-(6-chloro-1-methylindazol-3-yl)-N-[(1R)-1-(2-cyanocyclopropyl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(C)c4cc(Cl)ccc34)nc12)C1CC1C#N |
| InChI | InChI=1S/C27H32ClN7O2Si/c1-16(20-10-17(20)12-29)31-27(36)21-14-35(15-37-8-9-38(3,4)5)26-25(21)32-22(13-30-26)24-19-7-6-18(28)11-23(19)34(2)33-24/h6-7,11,13-14,16-17,20H,8-10,15H2,1-5H3,(H,31,36)/t16-,17?,20?/m1/s1 |
| InChIKey | LDOWGWQBKOFWFH-ZRZPHAQCSA-N |
| XLogP | 5.23 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.14 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|