C27H35ClN6O2Si — CID 71280605
2-[6-chloro-1-(cyclopropylmethyl)indazol-3-yl]-N-propan-2-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71280605) has the molecular formula C27H35ClN6O2Si and a molecular weight of 539.16 g/mol. Its IUPAC name is 2-[6-chloro-1-(cyclopropylmethyl)indazol-3-yl]-N-propan-2-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[6-chloro-1-(cyclopropylmethyl)indazol-3-yl]-N-propan-2-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71280605 |
| Molecular Formula | C27H35ClN6O2Si |
| Molecular Weight | 539.16 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 2-[6-chloro-1-(cyclopropylmethyl)indazol-3-yl]-N-propan-2-yl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(CC4CC4)c4cc(Cl)ccc34)nc12 |
| InChI | InChI=1S/C27H35ClN6O2Si/c1-17(2)30-27(35)21-15-33(16-36-10-11-37(3,4)5)26-25(21)31-22(13-29-26)24-20-9-8-19(28)12-23(20)34(32-24)14-18-6-7-18/h8-9,12-13,15,17-18H,6-7,10-11,14,16H2,1-5H3,(H,30,35) |
| InChIKey | PLNTVDGRRSDGLH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.16 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|