C17H24BrN3O3Si — CID 175983804
5-bromo-N-(oxetan-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 175983804) has the molecular formula C17H24BrN3O3Si and a molecular weight of 426.39 g/mol. Its IUPAC name is 5-bromo-N-(oxetan-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(oxetan-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175983804 |
| Molecular Formula | C17H24BrN3O3Si |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 5-bromo-N-(oxetan-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)NC2COC2)c2cc(Br)cnc21 |
| InChI | InChI=1S/C17H24BrN3O3Si/c1-25(2,3)5-4-23-11-21-8-15(17(22)20-13-9-24-10-13)14-6-12(18)7-19-16(14)21/h6-8,13H,4-5,9-11H2,1-3H3,(H,20,22) |
| InChIKey | YOXZHPBQTMOLPT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|