C35H44N6O6Si — CID 86726455
4-[[4-cyclobutyloxy-5-[4-(methylcarbamoyl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-3-methoxy-N-(oxetan-3-yl)benzamide (PubChem CID 86726455) has the molecular formula C35H44N6O6Si and a molecular weight of 672.86 g/mol. Its IUPAC name is 4-[[4-cyclobutyloxy-5-[4-(methylcarbamoyl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-3-methoxy-N-(oxetan-3-yl)benzamide.
| Compound Name | 4-[[4-cyclobutyloxy-5-[4-(methylcarbamoyl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-3-methoxy-N-(oxetan-3-yl)benzamide |
|---|---|
| PubChem CID | 86726455 |
| Molecular Formula | C35H44N6O6Si |
| Molecular Weight | 672.86 g/mol |
| Exact Mass | 672.31 |
| IUPAC Name | 4-[[4-cyclobutyloxy-5-[4-(methylcarbamoyl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-3-methoxy-N-(oxetan-3-yl)benzamide |
| SMILES | CNC(=O)c1ccc(-c2cn(COCC[Si](C)(C)C)c3nc(Nc4ccc(C(=O)NC5COC5)cc4OC)nc(OC4CCC4)c23)cc1 |
| InChI | InChI=1S/C35H44N6O6Si/c1-36-32(42)23-11-9-22(10-12-23)27-18-41(21-45-15-16-48(3,4)5)31-30(27)34(47-26-7-6-8-26)40-35(39-31)38-28-14-13-24(17-29(28)44-2)33(43)37-25-19-46-20-25/h9-14,17-18,25-26H,6-8,15-16,19-21H2,1-5H3,(H,36,42)(H,37,43)(H,38,39,40) |
| InChIKey | MSRKVNSQQNMMOI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 137.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.86 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|