C24H31ClN4O3Si — CID 86726454
4-[2-chloro-4-cyclobutyloxy-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]-N-methylbenzamide (PubChem CID 86726454) has the molecular formula C24H31ClN4O3Si and a molecular weight of 487.08 g/mol. Its IUPAC name is 4-[2-chloro-4-cyclobutyloxy-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]-N-methylbenzamide.
| Compound Name | 4-[2-chloro-4-cyclobutyloxy-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 86726454 |
| Molecular Formula | C24H31ClN4O3Si |
| Molecular Weight | 487.08 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 4-[2-chloro-4-cyclobutyloxy-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(-c2cn(COCC[Si](C)(C)C)c3nc(Cl)nc(OC4CCC4)c23)cc1 |
| InChI | InChI=1S/C24H31ClN4O3Si/c1-26-22(30)17-10-8-16(9-11-17)19-14-29(15-31-12-13-33(2,3)4)21-20(19)23(28-24(25)27-21)32-18-6-5-7-18/h8-11,14,18H,5-7,12-13,15H2,1-4H3,(H,26,30) |
| InChIKey | SXGBVUDJPWZRLR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.08 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|