C15H24Cl2N4O2Si — CID 166600427
3-[[2,5-dichloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 166600427) has the molecular formula C15H24Cl2N4O2Si and a molecular weight of 391.38 g/mol. Its IUPAC name is 3-[[2,5-dichloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[2,5-dichloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 166600427 |
| Molecular Formula | C15H24Cl2N4O2Si |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 3-[[2,5-dichloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | C[Si](C)(C)CCOCn1cc(Cl)c2c(NCCCO)nc(Cl)nc21 |
| InChI | InChI=1S/C15H24Cl2N4O2Si/c1-24(2,3)8-7-23-10-21-9-11(16)12-13(18-5-4-6-22)19-15(17)20-14(12)21/h9,22H,4-8,10H2,1-3H3,(H,18,19,20) |
| InChIKey | UUKXSECEIHOJPC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|