C22H31Cl2N7O5Si — CID 170590020
2,5-dichloro-N-[3-[3-methyl-4-nitro-1-(oxetan-3-yl)pyrazol-5-yl]oxypropyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 170590020) has the molecular formula C22H31Cl2N7O5Si and a molecular weight of 572.53 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-[3-methyl-4-nitro-1-(oxetan-3-yl)pyrazol-5-yl]oxypropyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-[3-[3-methyl-4-nitro-1-(oxetan-3-yl)pyrazol-5-yl]oxypropyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170590020 |
| Molecular Formula | C22H31Cl2N7O5Si |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | 2,5-dichloro-N-[3-[3-methyl-4-nitro-1-(oxetan-3-yl)pyrazol-5-yl]oxypropyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nn(C2COC2)c(OCCCNc2nc(Cl)nc3c2c(Cl)cn3COCC[Si](C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H31Cl2N7O5Si/c1-14-18(31(32)33)21(30(28-14)15-11-35-12-15)36-7-5-6-25-19-17-16(23)10-29(20(17)27-22(24)26-19)13-34-8-9-37(2,3)4/h10,15H,5-9,11-13H2,1-4H3,(H,25,26,27) |
| InChIKey | BJPNDDWYIJGAHS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|