C18H28ClN7OSi — CID 164740944
5-chloro-2-N-(1,3-dimethylpyrazol-4-yl)-4-N-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 164740944) has the molecular formula C18H28ClN7OSi and a molecular weight of 422.01 g/mol. Its IUPAC name is 5-chloro-2-N-(1,3-dimethylpyrazol-4-yl)-4-N-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-(1,3-dimethylpyrazol-4-yl)-4-N-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164740944 |
| Molecular Formula | C18H28ClN7OSi |
| Molecular Weight | 422.01 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 5-chloro-2-N-(1,3-dimethylpyrazol-4-yl)-4-N-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CNc1nc(Nc2cn(C)nc2C)nc2c1c(Cl)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H28ClN7OSi/c1-12-14(10-25(3)24-12)21-18-22-16(20-2)15-13(19)9-26(17(15)23-18)11-27-7-8-28(4,5)6/h9-10H,7-8,11H2,1-6H3,(H2,20,21,22,23) |
| InChIKey | YNIYOPQPKSOYEF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.01 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|