C22H30N6OSi — CID 140943320
4-cyclopropyl-6-[(1,4-dimethylpyrazol-3-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-3-carbonitrile (PubChem CID 140943320) has the molecular formula C22H30N6OSi and a molecular weight of 422.61 g/mol. Its IUPAC name is 4-cyclopropyl-6-[(1,4-dimethylpyrazol-3-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-3-carbonitrile.
| Compound Name | 4-cyclopropyl-6-[(1,4-dimethylpyrazol-3-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 140943320 |
| Molecular Formula | C22H30N6OSi |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 4-cyclopropyl-6-[(1,4-dimethylpyrazol-3-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-3-carbonitrile |
| SMILES | Cc1cn(C)nc1Nc1cc(C2CC2)c2c(C#N)cn(COCC[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C22H30N6OSi/c1-15-12-27(2)26-21(15)24-19-10-18(16-6-7-16)20-17(11-23)13-28(22(20)25-19)14-29-8-9-30(3,4)5/h10,12-13,16H,6-9,14H2,1-5H3,(H,24,25,26) |
| InChIKey | NDYOXFAVQVQAJI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 80.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|